2-fluoro-1,3,5-trimethyl-4-nitrobenzene structure
|
Common Name | 2-fluoro-1,3,5-trimethyl-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 386-66-3 | Molecular Weight | 183.18000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-fluoro-1,3,5-trimethyl-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H10FNO2 |
|---|---|
| Molecular Weight | 183.18000 |
| Exact Mass | 183.07000 |
| PSA | 45.82000 |
| LogP | 3.18230 |
| InChIKey | AZZZUUYOJHASHN-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c([N+](=O)[O-])c(C)c1F |
|
~%
2-fluoro-1,3,5-... CAS#:386-66-3 |
| Literature: Finger et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 153 Journal of the American Chemical Society, 1959 , vol. 81, p. 94,98 |
| 2-fluoro-1,3,5-trimethyl-4-nitro-benzene |
| 2-Fluor-4-nitro-mesitylen |
| Fluor-nitromesitylen |
| 2-Fluor-1,3,5-trimethyl-4-nitro-benzol |