2,6-dibromo-4-cyanophenyl butyrate structure
|
Common Name | 2,6-dibromo-4-cyanophenyl butyrate | ||
|---|---|---|---|---|
| CAS Number | 3861-41-4 | Molecular Weight | 347.00300 | |
| Density | 1.78g/cm3 | Boiling Point | 372.8ºC at 760 mmHg | |
| Molecular Formula | C11H9Br2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.3ºC | |
| Name | bromoxynil butyrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.78g/cm3 |
|---|---|
| Boiling Point | 372.8ºC at 760 mmHg |
| Molecular Formula | C11H9Br2NO2 |
| Molecular Weight | 347.00300 |
| Flash Point | 179.3ºC |
| Exact Mass | 344.90000 |
| PSA | 50.09000 |
| LogP | 3.78878 |
| Index of Refraction | 1.604 |
| InChIKey | PGMZYNZXIYOOHJ-UHFFFAOYSA-N |
| SMILES | CCCC(=O)Oc1c(Br)cc(C#N)cc1Br |
| RIDADR | UN 2588 |
|---|---|
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2926909090 |
|
~%
2,6-dibromo-4-c... CAS#:3861-41-4 |
| Literature: May u. Baker Ltd. Patent: FR1375311 , 1964 ; Chem.Abstr., 1965 , vol. 62, # 3982 |
|
~%
2,6-dibromo-4-c... CAS#:3861-41-4 |
| Literature: May u. Baker Ltd. Patent: FR1375311 , 1964 ; Chem.Abstr., 1965 , vol. 62, # 3982 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Caswell No. 119E |
| Bromoxynil butyrate [ISO] |
| 2,6-Dibrom-4-cyanophenyl-butyrat |
| Butyric acid,ester with 3,5-dibromo-4-hydroxybenzonitrile |
| EINECS 223-374-9 |
| 2,6-dibromo-4-cyanophenyl n-butyrate |
| Butanoic acid,2,6-dibromo-4-cyanophenyl ester |
| 2,6-dibromo-4-cyanophenyl butanoate |
| 2,6-dibromo-4-cyanophenyl butyrate |
| (2,6-dibromo-4-cyanophenyl) butanoate |
| Bromoxynil butyrate |