2-[[4-(diethylamino)phenyl]methyl]-3-hydroxy-2,3-dihydroinden-1-one
Modify Date: 2025-08-25 18:39:52
![2-[[4-(diethylamino)phenyl]methyl]-3-hydroxy-2,3-dihydroinden-1-one Structure](https://image.chemsrc.com/caspic/216/38615-39-3.png)
2-[[4-(diethylamino)phenyl]methyl]-3-hydroxy-2,3-dihydroinden-1-one structure
|
Common Name | 2-[[4-(diethylamino)phenyl]methyl]-3-hydroxy-2,3-dihydroinden-1-one | ||
|---|---|---|---|---|
| CAS Number | 38615-39-3 | Molecular Weight | 309.40200 | |
| Density | 1.184g/cm3 | Boiling Point | 484.3ºC at 760 mmHg | |
| Molecular Formula | C20H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.7ºC | |
| Name | 2-[[4-(diethylamino)phenyl]methyl]-3-hydroxy-2,3-dihydroinden-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.184g/cm3 |
|---|---|
| Boiling Point | 484.3ºC at 760 mmHg |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.40200 |
| Flash Point | 246.7ºC |
| Exact Mass | 309.17300 |
| PSA | 40.54000 |
| LogP | 3.62140 |
| Index of Refraction | 1.629 |
| InChIKey | OXKFXFCTILDPGA-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(CC2C(=O)c3ccccc3C2O)cc1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-[4-(diethylamino)benzyl]-3-hydroxyindan-1-one |
| EINECS 254-040-0 |
| 2-[[4-(DIETHYLAMINO)PHENYL]METHYL]-3-HYDROXYINDAN-1-ONE |