4-bis(3,4-dimethylphenoxy)phosphoryloxy-1,2-dimethyl-benzene structure
|
Common Name | 4-bis(3,4-dimethylphenoxy)phosphoryloxy-1,2-dimethyl-benzene | ||
|---|---|---|---|---|
| CAS Number | 3862-11-1 | Molecular Weight | 410.44300 | |
| Density | 1.154g/cm3 | Boiling Point | 496.5ºC at 760mmHg | |
| Molecular Formula | C24H27O4P | Melting Point | 72ºC | |
| MSDS | N/A | Flash Point | 267.2ºC | |
| Name | tris(3,4-dimethylphenyl) phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.154g/cm3 |
|---|---|
| Boiling Point | 496.5ºC at 760mmHg |
| Melting Point | 72ºC |
| Molecular Formula | C24H27O4P |
| Molecular Weight | 410.44300 |
| Flash Point | 267.2ºC |
| Exact Mass | 410.16500 |
| PSA | 54.57000 |
| LogP | 7.18190 |
| Index of Refraction | 1.569 |
| InChIKey | BCTKCHOESSAGCN-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OP(=O)(Oc2ccc(C)c(C)c2)Oc2ccc(C)c(C)c2)cc1C |
| HS Code | 2919900090 |
|---|
|
~%
4-bis(3,4-dimet... CAS#:3862-11-1 |
| Literature: Kreysler Chemische Berichte, 1885 , vol. 18, p. 1716 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 3,4-Xylenol Phosphate |
| phosphoric acid 3,4-xylyl ester |
| Tri-3,4-xylenyl phosphate |
| 3,4-dimethyl-phenol |
| Tris-<3,4-dimethyl-phenyl>-phosphat |