[1,1'-Biphenyl]-2,2'-dicarboximide structure
|
Common Name | [1,1'-Biphenyl]-2,2'-dicarboximide | ||
|---|---|---|---|---|
| CAS Number | 3864-08-2 | Molecular Weight | 223.22700 | |
| Density | 1.291g/cm3 | Boiling Point | 460.8ºC at 760 mmHg | |
| Molecular Formula | C14H9NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.7ºC | |
| Name | benzo[d][2]benzazepine-5,7-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.291g/cm3 |
|---|---|
| Boiling Point | 460.8ºC at 760 mmHg |
| Molecular Formula | C14H9NO2 |
| Molecular Weight | 223.22700 |
| Flash Point | 201.7ºC |
| Exact Mass | 223.06300 |
| PSA | 49.93000 |
| LogP | 2.04150 |
| Index of Refraction | 1.636 |
| InChIKey | CHEIXKXUYLUNQK-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(=O)c2ccccc2c2ccccc12 |
| HS Code | 2933990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| biphenyldicarboxylic acid imide |
| Dibenz[c,e]azepin-5,7-dion |
| 5h-dibenzo[c,e]azepine-5,7(6h)-dione |
| dibenzo[c,e]azepine-5,7-dione |
| 6,7-dihydro-5H-dibenzic<c,e>azepine-5,7-dione |
| 5H-dibenz[c,e]azepine-5,7(6H)-dione |
| Diphenimide |
| biphenyl-2,2'-dicarboximide |