N,N-dimethyl-2-(1-methylindol-3-yl)-2-oxo-acetamide structure
|
Common Name | N,N-dimethyl-2-(1-methylindol-3-yl)-2-oxo-acetamide | ||
|---|---|---|---|---|
| CAS Number | 38662-19-0 | Molecular Weight | 230.26200 | |
| Density | 1.16g/cm3 | Boiling Point | 389.1ºC at 760 mmHg | |
| Molecular Formula | C13H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.1ºC | |
| Name | N,N-dimethyl-2-(1-methylindol-3-yl)-2-oxoacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 389.1ºC at 760 mmHg |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.26200 |
| Flash Point | 189.1ºC |
| Exact Mass | 230.10600 |
| PSA | 42.31000 |
| LogP | 1.44920 |
| Index of Refraction | 1.584 |
| InChIKey | XGJUVNLQCLVABG-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C(=O)c1cn(C)c2ccccc12 |
| HS Code | 2924199090 |
|---|
|
~%
N,N-dimethyl-2-... CAS#:38662-19-0 |
| Literature: Upjohn Co. Patent: US2825734 , 1955 ; |
|
~%
N,N-dimethyl-2-... CAS#:38662-19-0 |
| Literature: Upjohn Co. Patent: US2825734 , 1955 ; |
|
~%
N,N-dimethyl-2-... CAS#:38662-19-0 |
| Literature: Upjohn Co. Patent: US2825734 , 1955 ; |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-Methylindol-3-glyoxyl-N,N-dimethylamid |
| N,N-dimethyl-2-(1-methyl-1H-indol-3-yl)-2-oxoacetamide |
| (1-methyl-indol-3-yl)-glyoxylic acid dimethylamide |
| (1-Methyl-indol-3-yl)-glyoxylsaeure-dimethylamid |
| 1,N,N-Trimethyl-3-indolglyoxamid |