4-(2-Carboxy-Ethyl)-2-Methyl-1H-Pyrrole-3-Carboxylic Acid Ethyl Ester structure
|
Common Name | 4-(2-Carboxy-Ethyl)-2-Methyl-1H-Pyrrole-3-Carboxylic Acid Ethyl Ester | ||
|---|---|---|---|---|
| CAS Number | 38664-16-3 | Molecular Weight | 225.241 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 445.3±45.0 °C at 760 mmHg | |
| Molecular Formula | C11H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.1±28.7 °C | |
| Name | 3-(4-ethoxycarbonyl-5-methyl-1H-pyrrol-3-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 445.3±45.0 °C at 760 mmHg |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.241 |
| Flash Point | 223.1±28.7 °C |
| Exact Mass | 225.100113 |
| PSA | 79.39000 |
| LogP | 1.76 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.545 |
| InChIKey | QKKNFEZKVKMSGW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(CCC(=O)O)c[nH]c1C |
|
~57%
4-(2-Carboxy-Et... CAS#:38664-16-3 |
| Literature: Butler; George Tetrahedron, 1993 , vol. 49, # 32 p. 7017 - 7026 |
|
~%
4-(2-Carboxy-Et... CAS#:38664-16-3 |
| Literature: Mauzerall; Granick Journal of Biological Chemistry, 1956 , vol. 219, p. 435,443 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-(2-Carboxy-indol-3-yl)-propionsaeure |
| 3-(2-carboxyethyl)-2-indolylcarboxylic acid |
| 3-(4-ethoxycarbonyl-5-methyl-pyrrol-3-yl)-propionic acid |
| ethyl 3-(2-carboxyethyl)-5-methylpyrrole-4-carboxylate |
| CIPA |
| 3-(2-Carboxy-ethyl)-1H-indole-2-carboxylic acid |
| 3-(4-ethoxycarbonyl-5-methyl-3-pyrrolyl)propanoic acid |
| 1H-Pyrrole-3-propanoic acid, 4-(ethoxycarbonyl)-5-methyl- |
| 3-(2-Carboxyindol-3-yl)propionic acid |
| 3-(4-Aethoxycarbonyl-5-methyl-pyrrol-3-yl)-propionsaeure |
| 4-(2-carboxy)ethyl-3-ethoxycarbonyl-2-methylpyrrole |
| 3-[4-(Ethoxycarbonyl)-5-methyl-1H-pyrrol-3-yl]propanoic acid |
| 3-(2-carboxyethyl)-4-ethoxycarbonyl-5-methylpyrrole |
| acide (carboxy-2 1H-indolyl-3)-3 propanoique |
| 1H-Indole-3-propanoic acid,2-carboxy |
| 2-carboxy-3-indolepropanoic acid |
| 4-(2-Carboxy-Ethyl)-2-Methyl-1H-Pyrrole-3-Carboxylic Acid Ethyl Ester |