1-(3,5-Dichlorophenyl)propane-1,2-dione
Modify Date: 2025-09-17 17:00:15
1-(3,5-Dichlorophenyl)propane-1,2-dione structure
|
Common Name | 1-(3,5-Dichlorophenyl)propane-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 386715-49-7 | Molecular Weight | 217.04900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3,5-Dichlorophenyl)propane-1,2-dione |
|---|
| Molecular Formula | C9H6Cl2O2 |
|---|---|
| Molecular Weight | 217.04900 |
| Exact Mass | 215.97400 |
| PSA | 34.14000 |
| LogP | 2.76510 |
| InChIKey | WWMMJQWHEMLODX-UHFFFAOYSA-N |
| SMILES | CC(=O)C(=O)c1cc(Cl)cc(Cl)c1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |