3-Cyclohexene-1-carboxylic acid, 2-(methylamino)-1-phenyl-, ethyl ester, (1R,2S)-rel- structure
|
Common Name | 3-Cyclohexene-1-carboxylic acid, 2-(methylamino)-1-phenyl-, ethyl ester, (1R,2S)-rel- | ||
|---|---|---|---|---|
| CAS Number | 38677-94-0 | Molecular Weight | 259.34300 | |
| Density | 1.07g/cm3 | Boiling Point | 349.2ºC at 760 mmHg | |
| Molecular Formula | C16H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165ºC | |
| Name | ethyl (1R,2S)-2-(methylamino)-1-phenylcyclohex-3-ene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 349.2ºC at 760 mmHg |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.34300 |
| Flash Point | 165ºC |
| Exact Mass | 259.15700 |
| PSA | 38.33000 |
| LogP | 2.81640 |
| Index of Refraction | 1.547 |
| InChIKey | PDJZPNKVLDWEKI-GOEBONIOSA-N |
| SMILES | CCOC(=O)C1(c2ccccc2)CCC=CC1NC |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Ethyl trans-(+)-2-(methylamino)-1-phenyl-3-cyclohexene-1-carboxylate |
| DL-trans-2-Monomethylamino-1-phenyl-cyclohex-3-en-trans-1-carbonsaeureethylester |
| (+/-)-ethyl trans-2-methylamino-1-phenyl-3-cyclohexene-trans-1-carboxylate |
| Nortilidine |