N-(6-chloro-2-methoxy-acridin-9-yl)-N,N-diethyl-1-(4-fluorophenyl)butane-1,4-diamine structure
|
Common Name | N-(6-chloro-2-methoxy-acridin-9-yl)-N,N-diethyl-1-(4-fluorophenyl)butane-1,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 3870-43-7 | Molecular Weight | 480.01700 | |
| Density | 1.215g/cm3 | Boiling Point | 630ºC at 760 mmHg | |
| Molecular Formula | C28H31ClFN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 334.8ºC | |
| Name | N4,N4-Diaethyl-N1-(6-chlor-2-methoxy-acridin-9-yl)-1-(4-fluor-phenyl)-butandiyldiamin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.215g/cm3 |
|---|---|
| Boiling Point | 630ºC at 760 mmHg |
| Molecular Formula | C28H31ClFN3O |
| Molecular Weight | 480.01700 |
| Flash Point | 334.8ºC |
| Exact Mass | 479.21400 |
| PSA | 37.39000 |
| LogP | 7.53730 |
| Index of Refraction | 1.637 |
| InChIKey | IUQXIOUBUALYAC-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCC(Nc1c2ccc(Cl)cc2nc2ccc(OC)cc12)c1ccc(F)cc1 |
|
~%
N-(6-chloro-2-m... CAS#:3870-43-7 |
| Literature: Humphlett; Weiss; Hauser Journal of the American Chemical Society, 1948 , vol. 70, p. 4020,4022 |
|
~%
N-(6-chloro-2-m... CAS#:3870-43-7 |
| Literature: Humphlett; Weiss; Hauser Journal of the American Chemical Society, 1948 , vol. 70, p. 4020,4022 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-Fluoro-7-chloro-9-(diethylamino-1-methylbutylamino)acridine |
| N4,N4-diethyl-N1-(6-chloro-2-methoxy-acridin-9-yl)-1-(4-fluoro-phenyl)-butanediyldiamine |
| n4-(6-chloro-2-fluoroacridin-9-yl)-n1,n1-diethylpentane-1,4-diamine |
| N4,N4-Diaethyl-N1-(6-chlor-2-fluor-acridin-9-yl)-1-methyl-butandiyldiamin |
| Fluoroquinacrine |
| N4,N4-diethyl-N1-(6-chloro-2-fluoro-acridin-9-yl)-1-methyl-butanediyldiamine |
| 1,4-Pentanediamine,N4-(6-chloro-2-fluoro-9-acridinyl)-N1,N1-diethyl |