4-(4,6-Dimethoxypyrimidin-2-yl)aniline
Modify Date: 2025-09-13 12:35:51
4-(4,6-Dimethoxypyrimidin-2-yl)aniline structure
|
Common Name | 4-(4,6-Dimethoxypyrimidin-2-yl)aniline | ||
|---|---|---|---|---|
| CAS Number | 387350-86-9 | Molecular Weight | 231.25100 | |
| Density | 1.207g/cm3 | Boiling Point | 318ºC at 760 mmHg | |
| Molecular Formula | C12H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.1ºC | |
| Name | 4-(4,6-Dimethoxypyrimidin-2-yl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 318ºC at 760 mmHg |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25100 |
| Flash Point | 146.1ºC |
| Exact Mass | 231.10100 |
| PSA | 70.26000 |
| LogP | 2.32420 |
| Index of Refraction | 1.59 |
| InChIKey | QMGUXTLACGZGBE-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)nc(-c2ccc(N)cc2)n1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| hms520p14 |