(E)-Ethyl 2-(4-Methoxy-3-(3-Methoxypropoxy)benzylidene)-3-Methylbutanoate structure
|
Common Name | (E)-Ethyl 2-(4-Methoxy-3-(3-Methoxypropoxy)benzylidene)-3-Methylbutanoate | ||
|---|---|---|---|---|
| CAS Number | 387356-94-7 | Molecular Weight | 336.42300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H28O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl (2E)-2-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methylidene]-3-methylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H28O5 |
|---|---|
| Molecular Weight | 336.42300 |
| Exact Mass | 336.19400 |
| PSA | 53.99000 |
| LogP | 3.71300 |
| InChIKey | HONSAQSVZXOATB-FOWTUZBSSA-N |
| SMILES | CCOC(=O)C(=Cc1ccc(OC)c(OCCCOC)c1)C(C)C |
| HS Code | 2918990090 |
|---|
|
~%
(E)-Ethyl 2-(4-... CAS#:387356-94-7 |
| Literature: Woodmansee, David H.; Mueller, Marc-Andre; Troendlin, Lars; Hoermann, Esther; Pfaltz, Andreas Chemistry - A European Journal, 2012 , vol. 18, # 43 p. 13780 - 13786 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (E)-ethyl 2-(4-methoxy-3-(3-methoxypropoxy)benzylidene)-3-methylbutanoate |
| ethyl (E)-2-(4-methoxy-3-(3-methoxypropoxy)benzylidene)-3-methylbutanoate |