2,2,2-trifluoro-N-(8-fluoro-9H-fluoren-2-yl)acetamide
Modify Date: 2025-08-24 23:03:37
2,2,2-trifluoro-N-(8-fluoro-9H-fluoren-2-yl)acetamide structure
|
Common Name | 2,2,2-trifluoro-N-(8-fluoro-9H-fluoren-2-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 3874-47-3 | Molecular Weight | 295.23200 | |
| Density | 1.461g/cm3 | Boiling Point | 411.6ºC at 760 mmHg | |
| Molecular Formula | C15H9F4NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.7ºC | |
| Name | 2,2,2-trifluoro-N-(8-fluoro-9H-fluoren-2-yl)acetamide |
|---|
| Density | 1.461g/cm3 |
|---|---|
| Boiling Point | 411.6ºC at 760 mmHg |
| Molecular Formula | C15H9F4NO |
| Molecular Weight | 295.23200 |
| Flash Point | 202.7ºC |
| Exact Mass | 295.06200 |
| PSA | 29.10000 |
| LogP | 3.97070 |
| Index of Refraction | 1.593 |
| InChIKey | GEZRZSQKJQSPTQ-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc2c(c1)Cc1c(F)cccc1-2)C(F)(F)F |
| HS Code | 2924299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:2251-20-9| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |