1-methoxy-4-[3-(4-methoxyphenoxy)propoxy]benzene
Modify Date: 2025-08-30 12:10:09
![1-methoxy-4-[3-(4-methoxyphenoxy)propoxy]benzene Structure](https://image.chemsrc.com/caspic/083/3875-75-0.png)
1-methoxy-4-[3-(4-methoxyphenoxy)propoxy]benzene structure
|
Common Name | 1-methoxy-4-[3-(4-methoxyphenoxy)propoxy]benzene | ||
|---|---|---|---|---|
| CAS Number | 3875-75-0 | Molecular Weight | 288.33800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methoxy-4-[3-(4-methoxyphenoxy)propoxy]benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H20O4 |
|---|---|
| Molecular Weight | 288.33800 |
| Exact Mass | 288.13600 |
| PSA | 36.92000 |
| LogP | 3.55170 |
| InChIKey | PYOAECQQLRDXPE-UHFFFAOYSA-N |
| SMILES | COc1ccc(OCCCOc2ccc(OC)cc2)cc1 |
| HS Code | 2909309090 |
|---|
|
~%
1-methoxy-4-[3-... CAS#:3875-75-0 |
| Literature: Kohn; Wilhelm Monatshefte fuer Chemie, 1922 , vol. 43, p. 553 |
|
~%
1-methoxy-4-[3-... CAS#:3875-75-0 |
| Literature: Willhalm,B. et al. Tetrahedron, 1964 , vol. 20, p. 1185 - 1209 |
|
~%
1-methoxy-4-[3-... CAS#:3875-75-0 |
| Literature: Kohn; Wilhelm Monatshefte fuer Chemie, 1922 , vol. 43, p. 553 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Name: qHTS screening for TAG (triacylglycerol) accumulators in algae
Source: 11812
Target: N/A
External Id: FATTTLab-Algae-Lipid
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
Total 2, Current Page 1 of 1
1
| 1,3-Di-p-methoxyphenoxypropan |
| Benzene,1,1'-[1,3-propanediylbis(oxy)]bis[4-methoxy |
| 1,3-bis-(4-methoxy-phenoxy)-propane |
| Trimethylenglykol-bis-(4-methoxy-phenylaether) |
| 1,1'-[propane-1,3-diylbis(oxy)]bis(4-methoxybenzene) |
| 4,4'-(Trimethylene-dioxy)-dianisole |