muristerone a structure
|
Common Name | muristerone a | ||
|---|---|---|---|---|
| CAS Number | 38778-30-2 | Molecular Weight | 496.634 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 707.2±60.0 °C at 760 mmHg | |
| Molecular Formula | C27H44O8 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 395.4±29.4 °C | |
Use of muristerone aMuristerone A is a phytoecdysteroid analog of ecdysone and a potent agonist of ecdysteroid receptor with a Kd of 1 nM[1]. |
| Name | (2S,3R,5S,9R,10R,11R,13R,14S,17S)-17-[(2R,3R)-2,3-dihydroxy-6-methylheptan-2-yl]-2,3,5,11,14-pentahydroxy-10,13-dimethyl-1,2,3,4,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-6-one |
|---|---|
| Synonym | More Synonyms |
| Description | Muristerone A is a phytoecdysteroid analog of ecdysone and a potent agonist of ecdysteroid receptor with a Kd of 1 nM[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 707.2±60.0 °C at 760 mmHg |
| Molecular Formula | C27H44O8 |
| Molecular Weight | 496.634 |
| Flash Point | 395.4±29.4 °C |
| Exact Mass | 496.303619 |
| PSA | 158.68000 |
| LogP | 0.27 |
| Vapour Pressure | 0.0±5.1 mmHg at 25°C |
| Index of Refraction | 1.610 |
| InChIKey | LRJUYAVTHIEHAI-LHBNDURVSA-N |
| SMILES | CC(C)CCC(O)C(C)(O)C1CCC2(O)C3=CC(=O)C4(O)CC(O)C(O)CC4(C)C3C(O)CC12C |
| Storage condition | −20°C |
| WGK Germany | 3 |
|---|
| Cholest-7-en-6-one, 2,3,5,11,14,20,22-heptahydroxy-, (2β,3β,5β,11α,22R)- |
| 2beta,3beta,5beta,11alpha,14alpha,20R,22R-Heptahydro xycholest-7-en-6-one |
| (2β,3β,5β,11α,22R)-2,3,5,11,14,20,22-Heptahydroxycholest-7-en-6-one |
| Muristerone |
| muristerone a |