Metofenazate structure
|
Common Name | Metofenazate | ||
|---|---|---|---|---|
| CAS Number | 388-51-2 | Molecular Weight | 598.15300 | |
| Density | 1.248 g/cm3 | Boiling Point | 694.7ºC at 760 mmHg | |
| Molecular Formula | C31H36ClN3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 374ºC | |
Use of MetofenazateMetofenazate is a selective calmodulin inhibitor. |
| Name | metofenazate |
|---|---|
| Synonym | More Synonyms |
| Description | Metofenazate is a selective calmodulin inhibitor. |
|---|---|
| Related Catalog | |
| Target |
Calmodulin[1] |
| References |
| Density | 1.248 g/cm3 |
|---|---|
| Boiling Point | 694.7ºC at 760 mmHg |
| Molecular Formula | C31H36ClN3O5S |
| Molecular Weight | 598.15300 |
| Flash Point | 374ºC |
| Exact Mass | 597.20600 |
| PSA | 89.01000 |
| LogP | 5.77400 |
| Index of Refraction | 1.6 |
| InChIKey | BAQLUVXNKOTTHU-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)OCCN2CCN(CCCN3c4ccccc4Sc4ccc(Cl)cc43)CC2)cc(OC)c1OC |
| Storage condition | 2-8℃ |
| 2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]piperazin-1-yl]ethyl 3,4,5-trimethoxybenzoate |
| Metofenazate [INN] |
| 1-<2-(3,4,5-Trimethoxy-benzoyloxy)-ethyl>-4-(3-<2-chlor-phenothiazinyl-(10)>-propyl)-piperazin |
| Metofenazatum |
| Metofenazato [INN-Spanish] |
| Frenolon |
| Metofenazatum [INN-Latin] |
| 1-(3-<2-Chlor-phenothiazinyl-(10)>-propyl)-4-<2-(3,4,5-trimethoxy-benzoyloxy)-ethyl>-piperazin |
| Metofenazato |
| Methophenazine |
| perphenazine |
| 3,4,5-trimethoxy-benzoic acid 2-{4-[3-(2-chloro-phenothiazin-10-yl)-propyl]-piperazin-1-yl}-ethyl ester |