9H-Fluoren-9-one, 4-bromo-2,5,7-trinitro-, compd. with benzene (1:1) structure
|
Common Name | 9H-Fluoren-9-one, 4-bromo-2,5,7-trinitro-, compd. with benzene (1:1) | ||
|---|---|---|---|---|
| CAS Number | 3882-77-7 | Molecular Weight | 472.20300 | |
| Density | N/A | Boiling Point | 600.5ºC at 760 mmHg | |
| Molecular Formula | C19H10BrN3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 317ºC | |
| Name | benzene,4-bromo-2,5,7-trinitrofluoren-9-one |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 600.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C19H10BrN3O7 |
| Molecular Weight | 472.20300 |
| Flash Point | 317ºC |
| Exact Mass | 470.97000 |
| PSA | 154.53000 |
| LogP | 6.64130 |
| InChIKey | GDAAVWUTNCEMTH-UHFFFAOYSA-N |
| SMILES | O=C1c2cc([N+](=O)[O-])cc(Br)c2-c2c1cc([N+](=O)[O-])cc2[N+](=O)[O-].c1ccccc1 |
| 9H-Fluoren-9-one,5,7-trinitro-,compd. with benzene (1:1) |