benzyl (4-hydroxy-2-iodophenyl)carbamate
benzyl (4-hydroxy-2-iodophenyl)carbamate structure
|
Common Name | benzyl (4-hydroxy-2-iodophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 388564-62-3 | Molecular Weight | 369.15400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12INO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Benzyl (4-hydroxy-2-iodophenyl)carbamate, CAS号 388564-62-3, molecular formula C14H12INO3, molecular weight 369.15400. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl (4-hydroxy-2-iodophenyl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H12INO3 |
|---|---|
| Molecular Weight | 369.15400 |
| Exact Mass | 368.98600 |
| PSA | 58.56000 |
| LogP | 3.81850 |
| InChIKey | YBSHKQRPYLZQLD-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(O)cc1I)OCc1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:212063-22-4This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of benzyl (4-hydroxy-2-iodophenyl)carbamate? |
| A: LogP of benzyl (4-hydroxy-2-iodophenyl)carbamate is 3.81850. |
| Q: What is the polar surface area (PSA) of benzyl (4-hydroxy-2-iodophenyl)carbamate? |
| A: Polar surface area (PSA) of benzyl (4-hydroxy-2-iodophenyl)carbamate is 58.56000. |
| Q: What is the English name of benzyl (4-hydroxy-2-iodophenyl)carbamate? |
| A: The English name of benzyl (4-hydroxy-2-iodophenyl)carbamate is benzyl (4-hydroxy-2-iodophenyl)carbamate. |
| Q: What is the molecular formula of benzyl (4-hydroxy-2-iodophenyl)carbamate? |
| A: Molecular formula of benzyl (4-hydroxy-2-iodophenyl)carbamate is C14H12INO3. |
| Q: What is the SMILES notation of benzyl (4-hydroxy-2-iodophenyl)carbamate? |
| A: SMILES notation of benzyl (4-hydroxy-2-iodophenyl)carbamate is O=C(Nc1ccc(O)cc1I)OCc1ccccc1. |
| Q: What are the downstream products of benzyl (4-hydroxy-2-iodophenyl)carbamate? |
| A: Related downstream products(CAS) of benzyl (4-hydroxy-2-iodophenyl)carbamate: 212063-22-4. |
| Q: What is the InChIKey of benzyl (4-hydroxy-2-iodophenyl)carbamate? |
| A: InChIKey of benzyl (4-hydroxy-2-iodophenyl)carbamate is YBSHKQRPYLZQLD-UHFFFAOYSA-N. |
| Q: What is the CAS number of benzyl (4-hydroxy-2-iodophenyl)carbamate? |
| A: CAS number of benzyl (4-hydroxy-2-iodophenyl)carbamate is 388564-62-3. |
| Q: What is the molecular weight of benzyl (4-hydroxy-2-iodophenyl)carbamate? |
| A: Molecular weight of benzyl (4-hydroxy-2-iodophenyl)carbamate is 369.15400. |
| Q: What is the Chinese name of 388564-62-3? |
| A: Chinese name of 388564-62-3 is 388564-62-3. |