4-[5-(4-Butylcyclohexyl)-1,2,4-oxadiazol-3-yl]-pyridinehydrochloride structure
|
Common Name | 4-[5-(4-Butylcyclohexyl)-1,2,4-oxadiazol-3-yl]-pyridinehydrochloride | ||
|---|---|---|---|---|
| CAS Number | 388575-52-8 | Molecular Weight | 285.384 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 440.1±47.0 °C at 760 mmHg | |
| Molecular Formula | C17H23N3O | Melting Point | N/A | |
| MSDS | USA | Flash Point | 209.8±23.3 °C | |
| Name | PSN 375963 hydrochloride,4-[5-(4-Butylcyclohexyl)-1,2,4-oxadiazol-3-yl]-pyridinehydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 440.1±47.0 °C at 760 mmHg |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.384 |
| Flash Point | 209.8±23.3 °C |
| Exact Mass | 285.184113 |
| PSA | 51.81000 |
| LogP | 5.16 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | OAVLEYPTWABFLF-UHFFFAOYSA-N |
| SMILES | CCCCC1CCC(c2nc(-c3ccncc3)no2)CC1 |
| Storage condition | -20℃ |
| RIDADR | NONH for all modes of transport |
|---|
| 4-[5-(4-Butylcyclohexyl)-1,2,4-oxadiazol-3-yl]pyridine |
| Pyridine, 4-[5-(4-butylcyclohexyl)-1,2,4-oxadiazol-3-yl]- |
| 4-[5-(4-butylcyclohexyl)-1,2,4-oxadiazol-3-yl]-pyridine |