N,N,N,N-tetrakis(2-chloroethyl)benzene-1,4-diamine structure
|
Common Name | N,N,N,N-tetrakis(2-chloroethyl)benzene-1,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 38859-44-8 | Molecular Weight | 358.13400 | |
| Density | 1.292g/cm3 | Boiling Point | 474.3ºC at 760 mmHg | |
| Molecular Formula | C14H20Cl4N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.6ºC | |
| Name | 1-N,1-N,4-N,4-N-tetrakis(2-chloroethyl)benzene-1,4-diamine |
|---|
| Density | 1.292g/cm3 |
|---|---|
| Boiling Point | 474.3ºC at 760 mmHg |
| Molecular Formula | C14H20Cl4N2 |
| Molecular Weight | 358.13400 |
| Flash Point | 240.6ºC |
| Exact Mass | 356.03800 |
| PSA | 6.48000 |
| LogP | 4.25460 |
| Index of Refraction | 1.584 |
| InChIKey | QYTMPKBDWSGBAB-UHFFFAOYSA-N |
| SMILES | ClCCN(CCCl)c1ccc(N(CCCl)CCCl)cc1 |
|
~%
N,N,N,N-tetraki... CAS#:38859-44-8 |
| Literature: Ross Journal of the Chemical Society, 1949 , p. 183,184 |
|
~%
N,N,N,N-tetraki... CAS#:38859-44-8 |
| Literature: Ross Journal of the Chemical Society, 1949 , p. 183,184 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |