6-(2-diethylaminoethoxy)-3,6-dimethyl-oct-4-yn-3-ol structure
|
Common Name | 6-(2-diethylaminoethoxy)-3,6-dimethyl-oct-4-yn-3-ol | ||
|---|---|---|---|---|
| CAS Number | 38873-27-7 | Molecular Weight | 269.42300 | |
| Density | 0.938g/cm3 | Boiling Point | 362.4ºC at 760 mmHg | |
| Molecular Formula | C16H31NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173ºC | |
| Name | 6-[2-(diethylamino)ethoxy]-3,6-dimethyloct-4-yn-3-ol |
|---|
| Density | 0.938g/cm3 |
|---|---|
| Boiling Point | 362.4ºC at 760 mmHg |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.42300 |
| Flash Point | 173ºC |
| Exact Mass | 269.23500 |
| PSA | 32.70000 |
| LogP | 2.67790 |
| Index of Refraction | 1.476 |
| InChIKey | OGOKFGNVHLBTQE-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOC(C)(C#CC(C)(O)CC)CC |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |