1-nitro-4-[(4-nitrophenoxy)-propan-2-ylphosphoryl]oxybenzene structure
|
Common Name | 1-nitro-4-[(4-nitrophenoxy)-propan-2-ylphosphoryl]oxybenzene | ||
|---|---|---|---|---|
| CAS Number | 38873-93-7 | Molecular Weight | 366.26300 | |
| Density | 1.392g/cm3 | Boiling Point | 514.4ºC at 760 mmHg | |
| Molecular Formula | C15H15N2O7P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.9ºC | |
| Name | 1-nitro-4-[(4-nitrophenoxy)-propan-2-ylphosphoryl]oxybenzene |
|---|
| Density | 1.392g/cm3 |
|---|---|
| Boiling Point | 514.4ºC at 760 mmHg |
| Molecular Formula | C15H15N2O7P |
| Molecular Weight | 366.26300 |
| Flash Point | 264.9ºC |
| Exact Mass | 366.06200 |
| PSA | 136.98000 |
| LogP | 5.60870 |
| Index of Refraction | 1.586 |
| InChIKey | BSKBMMUMSHDJFC-UHFFFAOYSA-N |
| SMILES | CC(C)P(=O)(Oc1ccc([N+](=O)[O-])cc1)Oc1ccc([N+](=O)[O-])cc1 |
|
~%
1-nitro-4-[(4-n... CAS#:38873-93-7 |
| Literature: Nidiry, Eugene Sebastian J.; Roy, N. K. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1988 , vol. 27, # 1-12 p. 1024 - 1028 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |