4-nitrophenyl phenylphosphonate structure
|
Common Name | 4-nitrophenyl phenylphosphonate | ||
|---|---|---|---|---|
| CAS Number | 38873-96-0 | Molecular Weight | 279.18500 | |
| Density | 1.478g/cm3 | Boiling Point | 524.4ºC at 760 mmHg | |
| Molecular Formula | C12H10NO5P | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | 271ºC | |
| Name | 4-nitrophenyl phenylphosphonate |
|---|
| Density | 1.478g/cm3 |
|---|---|
| Boiling Point | 524.4ºC at 760 mmHg |
| Molecular Formula | C12H10NO5P |
| Molecular Weight | 279.18500 |
| Flash Point | 271ºC |
| Exact Mass | 279.03000 |
| PSA | 102.16000 |
| LogP | 3.00770 |
| Index of Refraction | 1.634 |
| InChIKey | JLHBAYXOERKFGV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OP(=O)(Oc2ccccc2)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| HS Code | 2919900090 |
|---|
|
~26%
4-nitrophenyl p... CAS#:38873-96-0 |
| Literature: Genkina; Shipov; Mastryukova; Kabachnik Russian Journal of General Chemistry, 1996 , vol. 66, # 11 p. 1742 - 1744 |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |