Benzamide,N-(4-amino-2-hydroxyphenyl)- structure
|
Common Name | Benzamide,N-(4-amino-2-hydroxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 38880-90-9 | Molecular Weight | 228.24700 | |
| Density | 1.35g/cm3 | Boiling Point | 339.3ºC at 760mmHg | |
| Molecular Formula | C13H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159ºC | |
| Name | N-(4-amino-2-hydroxyphenyl)benzamide |
|---|
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 339.3ºC at 760mmHg |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.24700 |
| Flash Point | 159ºC |
| Exact Mass | 228.09000 |
| PSA | 75.35000 |
| LogP | 2.88090 |
| Index of Refraction | 1.722 |
| InChIKey | XBSZSDGIVSNDOF-UHFFFAOYSA-N |
| SMILES | Nc1ccc(NC(=O)c2ccccc2)c(O)c1 |
| HS Code | 2924299090 |
|---|
|
~80%
Benzamide,N-(4-... CAS#:38880-90-9 |
| Literature: Ertan, Tugba; Yildiz, Ilkay; Ozkan, Semiha; Temiz-Arpaci, Ozlem; Kaynak, Fatma; Yalcin, Ismail; Aki-Sener, Esin; Abbasoglu, Ufuk Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 5 p. 2032 - 2044 |
|
~%
Benzamide,N-(4-... CAS#:38880-90-9 |
| Literature: Ertan, Tugba; Yildiz, Ilkay; Ozkan, Semiha; Temiz-Arpaci, Ozlem; Kaynak, Fatma; Yalcin, Ismail; Aki-Sener, Esin; Abbasoglu, Ufuk Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 5 p. 2032 - 2044 |
|
~%
Benzamide,N-(4-... CAS#:38880-90-9 |
| Literature: Ertan, Tugba; Yildiz, Ilkay; Ozkan, Semiha; Temiz-Arpaci, Ozlem; Kaynak, Fatma; Yalcin, Ismail; Aki-Sener, Esin; Abbasoglu, Ufuk Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 5 p. 2032 - 2044 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |