N-[2,4-Bis(1,1-dimethylethyl)phenyl]acetamide structure
|
Common Name | N-[2,4-Bis(1,1-dimethylethyl)phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 38896-23-0 | Molecular Weight | 247.37600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H25NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2,4-ditert-butylphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H25NO |
|---|---|
| Molecular Weight | 247.37600 |
| Exact Mass | 247.19400 |
| PSA | 32.59000 |
| LogP | 4.88950 |
| InChIKey | TZFVZDNVBBQUGM-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(C(C)(C)C)cc1C(C)(C)C |
|
~%
N-[2,4-Bis(1,1-... CAS#:38896-23-0 |
| Literature: Legge Journal of the American Chemical Society, 1947 , vol. 69, p. 2079,2083 |
|
~%
N-[2,4-Bis(1,1-... CAS#:38896-23-0 |
| Literature: Legge Journal of the American Chemical Society, 1947 , vol. 69, p. 2079,2083 |
|
~%
N-[2,4-Bis(1,1-... CAS#:38896-23-0 |
| Literature: Legge Journal of the American Chemical Society, 1947 , vol. 69, p. 2079,2083 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Acetanilide,2,4-di-tert-butyl |
| Essigsaeure-(2,4-di-tert-butyl-anilid) |
| Acetamide,N-[2,4-bis(1,1-dimethylethyl)phenyl] |
| N-[2,4-Bis(1,1-dimethylethyl)phenyl]acetamide |
| 2',4'-di-t-butylacetanilide |
| acetic acid-(2,4-di-tert-butyl-anilide) |
| 2,4-Di-tert.-butylacetanilid |