(2E)-3-(9-ETHYL-9H-CARBAZOL-3-YL)ACRYLICACID structure
|
Common Name | (2E)-3-(9-ETHYL-9H-CARBAZOL-3-YL)ACRYLICACID | ||
|---|---|---|---|---|
| CAS Number | 38898-02-1 | Molecular Weight | 210.18300 | |
| Density | 1.308g/cm3 | Boiling Point | 333.4ºC at 760mmHg | |
| Molecular Formula | C10H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.4ºC | |
| Name | (2e)-3-{5-[(acetyloxy)methyl]-2-furyl}acrylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.308g/cm3 |
|---|---|
| Boiling Point | 333.4ºC at 760mmHg |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18300 |
| Flash Point | 155.4ºC |
| Exact Mass | 210.05300 |
| PSA | 76.74000 |
| LogP | 1.44050 |
| Index of Refraction | 1.56 |
| InChIKey | HYGANIWUSDOXIM-SNAWJCMRSA-N |
| SMILES | CC(=O)OCc1ccc(C=CC(=O)O)o1 |
| HS Code | 2932190090 |
|---|
|
~%
(2E)-3-(9-ETHYL... CAS#:38898-02-1 |
| Literature: Karashima Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, 1929 , vol. 180, p. 242 |
|
~%
(2E)-3-(9-ETHYL... CAS#:38898-02-1 |
| Literature: Karashima Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, 1929 , vol. 180, p. 242 |
|
~%
(2E)-3-(9-ETHYL... CAS#:38898-02-1 |
| Literature: Karashima Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, 1929 , vol. 180, p. 242 |
|
~%
(2E)-3-(9-ETHYL... CAS#:38898-02-1 |
| Literature: Karashima Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, 1929 , vol. 180, p. 242 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3-(5-acetoxymethyl-[2]furyl)-acrylic acid |
| 3-(5-Acetoxymethyl-[2]furyl)-acrylsaeure |
| 1(2h)-pyrimidinepropanoic acid,5-[bis(2-chloroethyl)amino]-3,4-dihydro-2,4-dioxo |
| 3-{5-[bis-(2-chloro-ethyl)-amino]-2,4-dioxo-3,4-dihydro-2H-pyrimidin-1-yl}-propionic acid |
| 3-(5-<Bis-(2-chlor-aethyl)-amino>-3,4-dihydro-2,4-dioxo-1(2H)-pyrimidin)-propionsaeure |