Arabinose, 2,3,4,5-tetraacetate, D- structure
|
Common Name | Arabinose, 2,3,4,5-tetraacetate, D- | ||
|---|---|---|---|---|
| CAS Number | 3891-58-5 | Molecular Weight | 318.27700 | |
| Density | 1.245g/cm3 | Boiling Point | 410.2ºC at 760mmHg | |
| Molecular Formula | C13H18O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180ºC | |
| Name | (2,3,4-triacetyloxy-5-oxopentyl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.245g/cm3 |
|---|---|
| Boiling Point | 410.2ºC at 760mmHg |
| Molecular Formula | C13H18O9 |
| Molecular Weight | 318.27700 |
| Flash Point | 180ºC |
| Exact Mass | 318.09500 |
| PSA | 122.27000 |
| InChIKey | ZYPMNZKYVVSXOJ-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(C=O)OC(C)=O |
| HS Code | 2915900090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 2,3,4,5-O-tetraacetyl-al-D-(-)-arabinose |
| aldehydo-D-arabinose tetraacetate |
| tetra-O-acetyl-D-arabinose |
| D-Arabinose tetraacetate |
| Arabinose,2,3,4,5-tetraacetate,D |
| (+)-aldehydo-D-arabinose 2,3,4,5-tetraacetate |
| Tetra-O-acetyl-aldehydo-D-arabinose |
| 2,3,4,5-tetra-O-acetyl-D-arabinose |
| 2,3,4,5-tetra-O-acetyl-aldehydo-D-arabinose |
| D-Arabinose 2,3,4,5-tetraacetate |