2-[2-[(2-methoxyacridin-9-yl)amino]ethylamino]ethanol structure
|
Common Name | 2-[2-[(2-methoxyacridin-9-yl)amino]ethylamino]ethanol | ||
|---|---|---|---|---|
| CAS Number | 38915-78-5 | Molecular Weight | 347.83900 | |
| Density | 1.244g/cm3 | Boiling Point | 580.4ºC at 760 mmHg | |
| Molecular Formula | C18H22ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 304.8ºC | |
| Name | 2-[2-[(2-methoxyacridin-9-yl)amino]ethylamino]ethanol,hydrochloride |
|---|
| Density | 1.244g/cm3 |
|---|---|
| Boiling Point | 580.4ºC at 760 mmHg |
| Molecular Formula | C18H22ClN3O2 |
| Molecular Weight | 347.83900 |
| Flash Point | 304.8ºC |
| Exact Mass | 347.14000 |
| PSA | 66.41000 |
| LogP | 3.65630 |
| Index of Refraction | 1.687 |
| InChIKey | DNXHYKAEDGGTER-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc3ccccc3c(NCCNCCO)c2c1.Cl |
| HS Code | 2933990090 |
|---|
|
~%
2-[2-[(2-methox... CAS#:38915-78-5 |
| Literature: Surrey et al. Journal of the American Chemical Society, 1952 , vol. 74, p. 4102 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |