1-[2-[(6-chloro-2-methoxy-acridin-9-yl)amino]ethylamino]propan-2-ol structure
|
Common Name | 1-[2-[(6-chloro-2-methoxy-acridin-9-yl)amino]ethylamino]propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 38919-48-1 | Molecular Weight | 396.31100 | |
| Density | 1.289g/cm3 | Boiling Point | 603.3ºC at 760 mmHg | |
| Molecular Formula | C19H23Cl2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 318.7ºC | |
| Name | 1-[2-[(6-chloro-2-methoxyacridin-9-yl)amino]ethylamino]propan-2-ol,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.289g/cm3 |
|---|---|
| Boiling Point | 603.3ºC at 760 mmHg |
| Molecular Formula | C19H23Cl2N3O2 |
| Molecular Weight | 396.31100 |
| Flash Point | 318.7ºC |
| Exact Mass | 395.11700 |
| PSA | 66.41000 |
| LogP | 4.69820 |
| Index of Refraction | 1.674 |
| InChIKey | MEBXOTMJQCVHEK-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(NCCNCC(C)O)c2c1.Cl |
|
~%
1-[2-[(6-chloro... CAS#:38919-48-1 |
| Literature: Surrey et al. Journal of the American Chemical Society, 1952 , vol. 74, p. 4102 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-[2-(6-chloro-2-methoxy-acridin-9-ylamino)-ethylamino]-propan-2-ol,dihydrochloride |
| 1-[2-(6-Chlor-2-methoxy-acridin-9-ylamino)-aethylamino]-propan-2-ol,Dihydrochlorid |