[3-methyl-2-(2-phenylethylcarbamoyl)-6-propan-2-ylphenyl] acetate
Modify Date: 2024-04-01 11:45:28
![[3-methyl-2-(2-phenylethylcarbamoyl)-6-propan-2-ylphenyl] acetate Structure](https://image.chemsrc.com/caspic/144/3894-08-4.png)
[3-methyl-2-(2-phenylethylcarbamoyl)-6-propan-2-ylphenyl] acetate structure
|
Common Name | [3-methyl-2-(2-phenylethylcarbamoyl)-6-propan-2-ylphenyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 3894-08-4 | Molecular Weight | 339.42800 | |
| Density | 1.091g/cm3 | Boiling Point | 440.6ºC at 760 mmHg | |
| Molecular Formula | C21H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.2ºC | |
| Name | [3-methyl-2-(2-phenylethylcarbamoyl)-6-propan-2-ylphenyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.091g/cm3 |
|---|---|
| Boiling Point | 440.6ºC at 760 mmHg |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.42800 |
| Flash Point | 220.2ºC |
| Exact Mass | 339.18300 |
| PSA | 58.89000 |
| LogP | 4.59100 |
| Index of Refraction | 1.551 |
| InChIKey | MPHSELCRHZKAAK-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1c(C(C)C)ccc(C)c1C(=O)NCCc1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Acetoxy-3-isopropyl-6-methyl-benzoesaeure-phenaethylamid |
| [3-methyl-2-(phenethylcarbamoyl)-6-propan-2-ylphenyl] acetate |
| 3-methyl-2-[(2-phenylethyl)carbamoyl]-6-(propan-2-yl)phenyl acetate |
| p-CYMENE-2-CARBOXAMIDE,3-HYDROXY-N-PHENETHYL-,ACETATE |
| 3-Hydroxy-N-phenethyl-p-cymene-2-carboxamide acetate |