3-oxo-3-(2,3,4-trimethoxyphenyl)propionic acid ethyl ester
Modify Date: 2025-08-25 18:09:16
3-oxo-3-(2,3,4-trimethoxyphenyl)propionic acid ethyl ester structure
|
Common Name | 3-oxo-3-(2,3,4-trimethoxyphenyl)propionic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 38975-83-6 | Molecular Weight | 282.28900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O6 | Melting Point | 87-89ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-oxo-3-(2,3,4-trimethoxyphenyl)propionic acid ethyl ester |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 87-89ºC |
|---|---|
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.28900 |
| Exact Mass | 282.11000 |
| PSA | 71.06000 |
| LogP | 1.84830 |
| InChIKey | IEORXFCOYQQQQA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1ccc(OC)c(OC)c1OC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-oxo-3-(2,3,4-trimethoxy-phenyl)-propionic acid ethyl ester |
| Ethyltrimethoxybenzoylacetate 345 |
| 2,3,4-Trimethoxybenzoylessigsaeureaethylester |
| ethyl 2-(2,3,4-trimethoxybenzoyl)acetate |
| ethyl (2,3,4-trimethoxybenzoyl)acetate |
| ethyl 3-oxo-3-(2',3',4'-trimethoxyphenyl)propanoate |