3-(2,4-dimethoxyanilino)-3-oxopropanoic acid
Modify Date: 2025-08-25 10:33:32
3-(2,4-dimethoxyanilino)-3-oxopropanoic acid structure
|
Common Name | 3-(2,4-dimethoxyanilino)-3-oxopropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 38989-32-1 | Molecular Weight | 239.22500 | |
| Density | 1.317g/cm3 | Boiling Point | 476.753ºC at 760 mmHg | |
| Molecular Formula | C11H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.132ºC | |
| Name | 3-(2,4-dimethoxyanilino)-3-oxopropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.317g/cm3 |
|---|---|
| Boiling Point | 476.753ºC at 760 mmHg |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.22500 |
| Flash Point | 242.132ºC |
| Exact Mass | 239.07900 |
| PSA | 84.86000 |
| LogP | 1.19000 |
| Index of Refraction | 1.576 |
| InChIKey | CBEUCURXDTTYJZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=O)CC(=O)O)c(OC)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Malonsaeure-mono-2,4-dimethoxy-anilid |