5-(cyclohexen-1-yl)-5-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione structure
|
Common Name | 5-(cyclohexen-1-yl)-5-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione | ||
|---|---|---|---|---|
| CAS Number | 3899-57-8 | Molecular Weight | 264.34300 | |
| Density | 1.26g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H16N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(cyclohexen-1-yl)-5-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.34300 |
| Exact Mass | 264.09300 |
| PSA | 97.27000 |
| LogP | 2.13200 |
| Index of Refraction | 1.606 |
| InChIKey | WASVKHBRDYJYHK-UHFFFAOYSA-N |
| SMILES | C=CCC1(C2=CCCCC2)C(=O)NC(=S)NC1=O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Allyl-5-cyclohex-1-enyl-2-thio-barbitursaeure |
| Kemithal-Saeure |
| Thialbarbital |
| 5-allyl-5-cyclohex-1-enyl-2-thio-barbituric acid |
| Isokemithal |
| 5-allyl-5-cyclohex-1-enyl-2-thioxo-dihydro-pyrimidine-4,6-dione |
| Cyclohexenyl-allyl-thiobarbitursaeure |
| Thialbarbiton |