1-benzyl-4-ethynyl-3-[1-(1H-indol-3-yl)ethyl]piperidin-4-ol structure
|
Common Name | 1-benzyl-4-ethynyl-3-[1-(1H-indol-3-yl)ethyl]piperidin-4-ol | ||
|---|---|---|---|---|
| CAS Number | 39002-10-3 | Molecular Weight | 358.47600 | |
| Density | 1.2g/cm3 | Boiling Point | 541.1ºC at 760 mmHg | |
| Molecular Formula | C24H26N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.1ºC | |
| Name | 1-benzyl-4-ethynyl-3-[1-(1H-indol-3-yl)ethyl]piperidin-4-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 541.1ºC at 760 mmHg |
| Molecular Formula | C24H26N2O |
| Molecular Weight | 358.47600 |
| Flash Point | 281.1ºC |
| Exact Mass | 358.20500 |
| PSA | 39.26000 |
| LogP | 4.09570 |
| Index of Refraction | 1.662 |
| InChIKey | OUYNHZITBWSXDY-UHFFFAOYSA-N |
| SMILES | C#CC1(O)CCN(Cc2ccccc2)CC1C(C)c1c[nH]c2ccccc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Piperidinol,1-benzyl-4-ethynyl-3-(1-(3-indolyl)ethyl) |
| 4-Piperidinol,4-ethynyl-3-(1-(1H-indol-3-yl)ethyl)-1-(phenylmethyl) |
| 1-benzyl-4-ethynyl-3-(1-indol-3-yl-ethyl)-piperidin-4-ol |
| ICIG 778 |
| 1-Benzyl-4-ethynyl-3-(1-(3-indolyl)ethyl)-4-piperidinol |