Rhodexoside
Modify Date: 2025-09-11 08:19:17
Rhodexoside structure
|
Common Name | Rhodexoside | ||
|---|---|---|---|---|
| CAS Number | 39007-98-2 | Molecular Weight | 698.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C35H54O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Rhodexoside |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C35H54O14 |
|---|---|
| Molecular Weight | 698.8 |
| InChIKey | JSZSULSFHPSNTE-OSUGLFFKSA-N |
| SMILES | CC1OC(OC2CCC3(C)C(CCC4C3C(O)CC3(C)C(C5=CC(=O)OC5)CCC43O)C2)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Rhodexoside? |
| A: Molecular weight of Rhodexoside is 698.8. |
| Q: What is the InChIKey of Rhodexoside? |
| A: InChIKey of Rhodexoside is JSZSULSFHPSNTE-OSUGLFFKSA-N. |
| Q: What is the CAS number of Rhodexoside? |
| A: CAS number of Rhodexoside is 39007-98-2. |
| Q: What is the English name of Rhodexoside? |
| A: The English name of Rhodexoside is Rhodexoside. |
| Q: What is the SMILES notation of Rhodexoside? |
| A: SMILES notation of Rhodexoside is CC1OC(OC2CCC3(C)C(CCC4C3C(O)CC3(C)C(C5=CC(=O)OC5)CCC43O)C2)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O. |
| Q: What is the molecular formula of Rhodexoside? |
| A: Molecular formula of Rhodexoside is C35H54O14. |
| Q: What is the Chinese name of 39007-98-2? |
| A: Chinese name of 39007-98-2 is 39007-98-2. |