1-[(5S)-2-(3-Furyl)-5-methyl-1-cyclopenten-1-yl]-3-methyl-2-buten-1-one structure
|
Common Name | 1-[(5S)-2-(3-Furyl)-5-methyl-1-cyclopenten-1-yl]-3-methyl-2-buten-1-one | ||
|---|---|---|---|---|
| CAS Number | 39031-29-3 | Molecular Weight | 230.30200 | |
| Density | 1.05g/cm3 | Boiling Point | 340.7ºC at 760 mmHg | |
| Molecular Formula | C15H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.3ºC | |
| Name | 1-[2-(furan-3-yl)-5-methylcyclopenten-1-yl]-3-methylbut-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 340.7ºC at 760 mmHg |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.30200 |
| Flash Point | 159.3ºC |
| Exact Mass | 230.13100 |
| PSA | 30.21000 |
| LogP | 3.99840 |
| Index of Refraction | 1.524 |
| InChIKey | UFRHZDWJDMQBIC-NSHDSACASA-N |
| SMILES | CC(C)=CC(=O)C1=C(c2ccoc2)CCC1C |
| HS Code | 2932190090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-BUTEN-1-ONE,1-(2-(3-FURANYL)-5-METHYL-1-CYCLOPENTEN-1-YL)-3-METHYL-,(S) |
| Dehydromyodesmone |
| (S)-1-(2-(3-Furanyl)-5-methyl-1-cyclopenten-1-yl)-3-methyl-2-buten-1-one |
| 1-[2-(furan-3-yl)-5-methylcyclopent-1-en-1-yl]-3-methylbut-2-en-1-one |