RHPS4 structure
|
Common Name | RHPS4 | ||
|---|---|---|---|---|
| CAS Number | 390362-78-4 | Molecular Weight | 458.48 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H17F2N2.CH3O4S | Melting Point | 256-258 ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of RHPS4RHPS4 is a potent inhibitor of Telomerase at submicromolar. |
| Name | RHPS4 |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 256-258 ºC |
|---|---|
| Molecular Formula | C22H17F2N2.CH3O4S |
| Molecular Weight | 458.48 |
| InChIKey | VRWGYMXWYZBBGF-UHFFFAOYSA-M |
| SMILES | COS(=O)(=O)[O-].Cc1cc2c3c([n+](C)c4ccc(F)cc4c3c1)-c1cc(F)ccc1N2C |
| Storage condition | -20℃ |
| 3,11-Difluoro-6,8,13-trimethyl-8H-quino[4,3,2-kl]acridinium methyl sulfate |