2H-Isoindole-2-aceticacid, 1,3,3a,4,7,7a-hexahydro-1,3-dioxo- structure
|
Common Name | 2H-Isoindole-2-aceticacid, 1,3,3a,4,7,7a-hexahydro-1,3-dioxo- | ||
|---|---|---|---|---|
| CAS Number | 39059-06-8 | Molecular Weight | 209.19900 | |
| Density | 1.392g/cm3 | Boiling Point | 481.1ºC at 760 mmHg | |
| Molecular Formula | C10H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.7ºC | |
| Name | 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.392g/cm3 |
|---|---|
| Boiling Point | 481.1ºC at 760 mmHg |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.19900 |
| Flash Point | 244.7ºC |
| Exact Mass | 209.06900 |
| PSA | 74.68000 |
| Index of Refraction | 1.569 |
| InChIKey | HUBCVSQYCPCWEB-UHFFFAOYSA-N |
| SMILES | O=C(O)CN1C(=O)C2CC=CCC2C1=O |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| (1,3-Dioxo-1,3,3a,4,7,7a-hexahydro-isoindol-2-yl)-acetic acid |
| (1,3-dioxo-1,3,3a,4,7,7a-hexahydro-2H-isoindol-2-yl)acetic acid |