diethyl 2-[(2,3-dimethoxyphenyl)methylidene]propanedioate
Modify Date: 2025-09-30 18:24:52
![diethyl 2-[(2,3-dimethoxyphenyl)methylidene]propanedioate Structure](https://image.chemsrc.com/caspic/315/39059-74-0.png)
diethyl 2-[(2,3-dimethoxyphenyl)methylidene]propanedioate structure
|
Common Name | diethyl 2-[(2,3-dimethoxyphenyl)methylidene]propanedioate | ||
|---|---|---|---|---|
| CAS Number | 39059-74-0 | Molecular Weight | 308.32600 | |
| Density | 1.151g/cm3 | Boiling Point | 381.3ºC at 760 mmHg | |
| Molecular Formula | C16H20O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.9ºC | |
| Name | diethyl 2-[(2,3-dimethoxyphenyl)methylidene]propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.151g/cm3 |
|---|---|
| Boiling Point | 381.3ºC at 760 mmHg |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.32600 |
| Flash Point | 164.9ºC |
| Exact Mass | 308.12600 |
| PSA | 71.06000 |
| LogP | 2.21340 |
| Index of Refraction | 1.525 |
| InChIKey | VCHSRJSLOQLZKE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=Cc1cccc(OC)c1OC)C(=O)OCC |
| HS Code | 2918990090 |
|---|
|
~87%
diethyl 2-[(2,3... CAS#:39059-74-0 |
| Literature: Sohda; Mizuno; Hirata; Maki; Kawamatsu Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 2 p. 560 - 569 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:81017-29-0| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| diethyl 2,3-dimethoxybenzylidenemalonate |