6-chlorobenzo[de]isoquinoline-1,3-dione structure
|
Common Name | 6-chlorobenzo[de]isoquinoline-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 39061-32-0 | Molecular Weight | 231.63500 | |
| Density | 1.507g/cm3 | Boiling Point | 491.2ºC at 760 mmHg | |
| Molecular Formula | C12H6ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.9ºC | |
| Name | 6-chlorobenzo[de]isoquinoline-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.507g/cm3 |
|---|---|
| Boiling Point | 491.2ºC at 760 mmHg |
| Molecular Formula | C12H6ClNO2 |
| Molecular Weight | 231.63500 |
| Flash Point | 250.9ºC |
| Exact Mass | 231.00900 |
| PSA | 49.93000 |
| LogP | 2.13270 |
| Index of Refraction | 1.712 |
| InChIKey | PFNUDUPCMCKPRD-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)c2ccc(Cl)c3cccc1c23 |
| HS Code | 2933990090 |
|---|
|
~%
6-chlorobenzo[d... CAS#:39061-32-0 |
| Literature: Karischin; Kustol Zhurnal Obshchei Khimii, 1958 , vol. 28, p. 692,693;engl.Ausg.S.673 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-chloronaphthalene-1,8-dicarboximide |
| 6-Chlor-benz[de]isochinolin-1,3-dion |
| 4-chloro-1,8-naphthaliimide |
| 4-Chloronaphthalimide |
| 4-chloronaphthylimide |
| 6-chloro-benz[de]isoquinoline-1,3-dione |