Benzoic acid,5-(phenylmethoxy)-2-[[3-(trifluoromethyl)phenyl]amino] structure
|
Common Name | Benzoic acid,5-(phenylmethoxy)-2-[[3-(trifluoromethyl)phenyl]amino] | ||
|---|---|---|---|---|
| CAS Number | 39062-65-2 | Molecular Weight | 387.35200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H16F3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-phenylmethoxy-2-[(3-trifluoromethylphenyl)amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H16F3NO3 |
|---|---|
| Molecular Weight | 387.35200 |
| Exact Mass | 387.10800 |
| PSA | 58.56000 |
| LogP | 5.79920 |
| InChIKey | PHVZMXJNSKCKGL-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(OCc2ccccc2)ccc1Nc1cccc(C(F)(F)F)c1 |
| HS Code | 2922509090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-Benzyloxy-N-(α,α,α-trifluor-m-tolyl)-anthranilsaeure |
| 5-Benzyloxyflufenaminsaeure |