(7α,19Z)-12-Hydroxyajmal-19-en-17-one structure
|
Common Name | (7α,19Z)-12-Hydroxyajmal-19-en-17-one | ||
|---|---|---|---|---|
| CAS Number | 3911-19-1 | Molecular Weight | 322.401 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 522.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H22N2O2 | Melting Point | 322℃ | |
| MSDS | N/A | Flash Point | 269.6±30.1 °C | |
Use of (7α,19Z)-12-Hydroxyajmal-19-en-17-oneMitoridine is an indole alkaloid compound isolated from the stem bark of Rauwolfia cumminsii Stapf[1]. |
| Name | 12-hydroxy-ajmal-19-en-17-one |
|---|---|
| Synonym | More Synonyms |
| Description | Mitoridine is an indole alkaloid compound isolated from the stem bark of Rauwolfia cumminsii Stapf[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 522.1±50.0 °C at 760 mmHg |
| Melting Point | 322℃ |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.401 |
| Flash Point | 269.6±30.1 °C |
| Exact Mass | 322.168121 |
| PSA | 43.78000 |
| LogP | 2.05 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.722 |
| InChIKey | VVLPFXAEVKKWTK-QVLBJKKOSA-N |
| SMILES | CC=C1CN2C3CC45C(=O)C3C1CC2C4N(C)c1c(O)cccc15 |
| Mitoridine |
| (7α,19Z)-12-Hydroxyajmal-19-en-17-one |
| Ajmal-19-en-17-one, 12-hydroxy-, (7α,19Z)- |