2-(4-bromo-2-fluoroanilino)-3,4-difluorobenzoic acid structure
|
Common Name | 2-(4-bromo-2-fluoroanilino)-3,4-difluorobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 391212-04-7 | Molecular Weight | 346.09900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H7BrF3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-bromo-2-fluoroanilino)-3,4-difluorobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H7BrF3NO2 |
|---|---|
| Molecular Weight | 346.09900 |
| Exact Mass | 344.96100 |
| PSA | 49.33000 |
| LogP | 4.38120 |
| InChIKey | LYWJUDIKFYOXSP-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(F)c(F)c1Nc1ccc(Br)cc1F |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2-((4-Bromo-2-fluorophenyl)amino)-3,4-difluorobenzoic acid |