3-(4-bromophenyl)-2-sulfanylideneimidazolidin-4-one
3-(4-bromophenyl)-2-sulfanylideneimidazolidin-4-one structure
|
Common Name | 3-(4-bromophenyl)-2-sulfanylideneimidazolidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 39123-60-9 | Molecular Weight | 271.13400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7BrN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(4-bromophenyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H7BrN2OS |
|---|---|
| Molecular Weight | 271.13400 |
| Exact Mass | 269.94600 |
| PSA | 71.47000 |
| LogP | 1.58210 |
| InChIKey | LVPAIPMYPQDTHY-UHFFFAOYSA-N |
| SMILES | O=C1CNC(=S)N1c1ccc(Br)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~91%
3-(4-bromopheny... CAS#:39123-60-9 |
| Literature: Li, Jian-Ping; Ma, Chun-Ming; Qu, Gui-Rong Synthetic Communications, 2005 , vol. 35, # 9 p. 1203 - 1208 |
|
~%
3-(4-bromopheny... CAS#:39123-60-9 |
| Literature: Mindl, Jaromir; Sterba, Vojeslav Collection of Czechoslovak Chemical Communications, 1987 , vol. 52, # 1 p. 156 - 161 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-(4-bromophenyl)-2-thiohydantoin |
| 4-Imidazolidinone,3-(4-bromophenyl)-2-thioxo |
| 3-(4-bromo-phenyl)-2-thioxo-imidazolidin-4-one |
| 3-(p-bromophenyl)-2-thiohydantoin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-(4-bromophenyl)-2-sulfanylideneimidazolidin-4-one? |
| A: Molecular formula of 3-(4-bromophenyl)-2-sulfanylideneimidazolidin-4-one is C9H7BrN2OS. |
| Q: What is the molecular weight of 3-(4-bromophenyl)-2-sulfanylideneimidazolidin-4-one? |
| A: Molecular weight of 3-(4-bromophenyl)-2-sulfanylideneimidazolidin-4-one is 271.13400. |
| Q: What English synonyms does 3-(4-bromophenyl)-2-sulfanylideneimidazolidin-4-one have? |
| A: English synonyms of 3-(4-bromophenyl)-2-sulfanylideneimidazolidin-4-one: 3-(4-bromophenyl)-2-thiohydantoin, 4-Imidazolidinone,3-(4-bromophenyl)-2-thioxo, 3-(4-bromo-phenyl)-2-thioxo-imidazolidin-4-one, 3-(p-bromophenyl)-2-thiohydantoin. |
| Q: What is the English name of 3-(4-bromophenyl)-2-sulfanylideneimidazolidin-4-one? |
| A: The English name of 3-(4-bromophenyl)-2-sulfanylideneimidazolidin-4-one is 3-(4-bromophenyl)-2-sulfanylideneimidazolidin-4-one. |
| Q: What is the Chinese name of 39123-60-9? |
| A: Chinese name of 39123-60-9 is 39123-60-9. |
| Q: What are the upstream materials of 3-(4-bromophenyl)-2-sulfanylideneimidazolidin-4-one? |
| A: Related upstream materials(CAS) of 3-(4-bromophenyl)-2-sulfanylideneimidazolidin-4-one: 56-40-6;1985-12-2;111634-00-5. |
| Q: What is the polar surface area (PSA) of 3-(4-bromophenyl)-2-sulfanylideneimidazolidin-4-one? |
| A: Polar surface area (PSA) of 3-(4-bromophenyl)-2-sulfanylideneimidazolidin-4-one is 71.47000. |
| Q: What is the SMILES notation of 3-(4-bromophenyl)-2-sulfanylideneimidazolidin-4-one? |
| A: SMILES notation of 3-(4-bromophenyl)-2-sulfanylideneimidazolidin-4-one is O=C1CNC(=S)N1c1ccc(Br)cc1. |
| Q: What is the InChIKey of 3-(4-bromophenyl)-2-sulfanylideneimidazolidin-4-one? |
| A: InChIKey of 3-(4-bromophenyl)-2-sulfanylideneimidazolidin-4-one is LVPAIPMYPQDTHY-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-(4-bromophenyl)-2-sulfanylideneimidazolidin-4-one? |
| A: CAS number of 3-(4-bromophenyl)-2-sulfanylideneimidazolidin-4-one is 39123-60-9. |