1-FMOC-4-CYANOPIPERIDINE structure
|
Common Name | 1-FMOC-4-CYANOPIPERIDINE | ||
|---|---|---|---|---|
| CAS Number | 391248-16-1 | Molecular Weight | 332.39600 | |
| Density | 1.26g/cm3 | Boiling Point | 537.8ºC at 760mmHg | |
| Molecular Formula | C21H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279ºC | |
| Name | 9H-fluoren-9-ylmethyl 4-cyanopiperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 537.8ºC at 760mmHg |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.39600 |
| Flash Point | 279ºC |
| Exact Mass | 332.15200 |
| PSA | 53.33000 |
| LogP | 4.10898 |
| Index of Refraction | 1.638 |
| InChIKey | RASKRSBORLJDKF-UHFFFAOYSA-N |
| SMILES | N#CC1CCN(C(=O)OCC2c3ccccc3-c3ccccc32)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-cyano-piperidine-1-carboxylic acid 9h-fluoren-9-ylmethyl ester |
| 1-Fmoc-4-Cyanopiperidine |
| 1-n-fmoc-4-cyanopiperidine |
| 4-Cyano-1-piperidinecarboxylic acid 9H-fluoren-9-ylmethyl ester |
| 4-Cyano-1-N-Fmoc-piperidine |