N-((1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)acetyl)glycine structure
|
Common Name | N-((1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)acetyl)glycine | ||
|---|---|---|---|---|
| CAS Number | 3916-40-3 | Molecular Weight | 262.21800 | |
| Density | 1.509g/cm3 | Boiling Point | 583.9ºC at 760mmHg | |
| Molecular Formula | C12H10N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306.9ºC | |
| Name | 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.509g/cm3 |
|---|---|
| Boiling Point | 583.9ºC at 760mmHg |
| Molecular Formula | C12H10N2O5 |
| Molecular Weight | 262.21800 |
| Flash Point | 306.9ºC |
| Exact Mass | 262.05900 |
| PSA | 103.78000 |
| Index of Refraction | 1.625 |
| InChIKey | GGZCEFKSVHSZHT-UHFFFAOYSA-N |
| SMILES | O=C(O)CNC(=O)CN1C(=O)c2ccccc2C1=O |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| Glycine,N-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)acetyl] |
| F0850-1885 |
| N-[(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)acetyl]glycine |
| N-(N,N-Phthaloyl-glycyl)-glycin |
| N-(N,N-phthaloyl-glycyl)-glycine |
| N-((1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)acetyl)glycine |
| phthalylglycylglycine |
| N-Phthaloylglycylglycine |