1,3,3a,8a-Tetrahydro-3a-methylindeno[2,1-b]pyrrole-2,8-dione
Modify Date: 2026-07-19 10:28:41
![1,3,3a,8a-Tetrahydro-3a-methylindeno[2,1-b]pyrrole-2,8-dione Structure](https://www.chemsrc.com/extcaspic/478/39160-35-5.png)
1,3,3a,8a-Tetrahydro-3a-methylindeno[2,1-b]pyrrole-2,8-dione structure
|
Common Name | 1,3,3a,8a-Tetrahydro-3a-methylindeno[2,1-b]pyrrole-2,8-dione | ||
|---|---|---|---|---|
| CAS Number | 39160-35-5 | Molecular Weight | 201.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3,3a,8a-Tetrahydro-3a-methylindeno[2,1-b]pyrrole-2,8-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H11NO2 |
|---|---|
| Molecular Weight | 201.22 |
| InChIKey | JOXPDERMOJILEA-UHFFFAOYSA-N |
| SMILES | CC12CC(=O)NC1C(=O)c1ccccc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1,3,3a,8a-Tetrahydro-3a-methylindeno[2,1-b]pyrrole-2,8-dione? |
| A: InChIKey of 1,3,3a,8a-Tetrahydro-3a-methylindeno[2,1-b]pyrrole-2,8-dione is JOXPDERMOJILEA-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1,3,3a,8a-Tetrahydro-3a-methylindeno[2,1-b]pyrrole-2,8-dione? |
| A: Molecular formula of 1,3,3a,8a-Tetrahydro-3a-methylindeno[2,1-b]pyrrole-2,8-dione is C12H11NO2. |
| Q: What is the molecular weight of 1,3,3a,8a-Tetrahydro-3a-methylindeno[2,1-b]pyrrole-2,8-dione? |
| A: Molecular weight of 1,3,3a,8a-Tetrahydro-3a-methylindeno[2,1-b]pyrrole-2,8-dione is 201.22. |
| Q: What is the CAS number of 1,3,3a,8a-Tetrahydro-3a-methylindeno[2,1-b]pyrrole-2,8-dione? |
| A: CAS number of 1,3,3a,8a-Tetrahydro-3a-methylindeno[2,1-b]pyrrole-2,8-dione is 39160-35-5. |
| Q: What is the English name of 1,3,3a,8a-Tetrahydro-3a-methylindeno[2,1-b]pyrrole-2,8-dione? |
| A: The English name of 1,3,3a,8a-Tetrahydro-3a-methylindeno[2,1-b]pyrrole-2,8-dione is 1,3,3a,8a-Tetrahydro-3a-methylindeno[2,1-b]pyrrole-2,8-dione. |
| Q: What is the SMILES notation of 1,3,3a,8a-Tetrahydro-3a-methylindeno[2,1-b]pyrrole-2,8-dione? |
| A: SMILES notation of 1,3,3a,8a-Tetrahydro-3a-methylindeno[2,1-b]pyrrole-2,8-dione is CC12CC(=O)NC1C(=O)c1ccccc12. |
| Q: What is the Chinese name of 39160-35-5? |
| A: Chinese name of 39160-35-5 is 39160-35-5. |