N,N-dimethyl-2-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide structure
|
Common Name | N,N-dimethyl-2-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 3918-24-9 | Molecular Weight | 217.30700 | |
| Density | 1.052g/cm3 | Boiling Point | 359.7ºC at 760 mmHg | |
| Molecular Formula | C14H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.8ºC | |
| Name | N,N-dimethyl-2-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.052g/cm3 |
|---|---|
| Boiling Point | 359.7ºC at 760 mmHg |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.30700 |
| Flash Point | 162.8ºC |
| Exact Mass | 217.14700 |
| PSA | 20.31000 |
| LogP | 2.19610 |
| Index of Refraction | 1.548 |
| InChIKey | HJCHQUDUGMGPSE-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)Cc1cccc2c1CCCC2 |
| HS Code | 2924299090 |
|---|
|
~%
N,N-dimethyl-2-... CAS#:3918-24-9 |
| Literature: Felix,D. et al. Helvetica Chimica Acta, 1969 , vol. 52, p. 1030 - 1042 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N-Dimethyl-5,6,7,8-tetrahydro-1-naphthaleneacetamide |
| 1,2,3,4-Tetrahydro-naphthalin-5-essigsaeure-N,N-dimethylamid |
| 1-NAPHTHALENEACETAMIDE,5,6,7,8-TETRAHYDRO-N,N-DIMETHYL |