ethyl 5-[2-[(2,6-dimethoxybenzoyl)amino]benzoyl]oxy-2-methyl-1-phenyl-indole-3-carboxylate
Modify Date: 2026-07-15 13:18:44
![ethyl 5-[2-[(2,6-dimethoxybenzoyl)amino]benzoyl]oxy-2-methyl-1-phenyl-indole-3-carboxylate Structure](https://www.chemsrc.com/extcaspic/005/391862-33-2.png)
ethyl 5-[2-[(2,6-dimethoxybenzoyl)amino]benzoyl]oxy-2-methyl-1-phenyl-indole-3-carboxylate structure
|
Common Name | ethyl 5-[2-[(2,6-dimethoxybenzoyl)amino]benzoyl]oxy-2-methyl-1-phenyl-indole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 391862-33-2 | Molecular Weight | 578.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H30N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 5-[2-[(2,6-dimethoxybenzoyl)amino]benzoyl]oxy-2-methyl-1-phenyl-indole-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C34H30N2O7 |
|---|---|
| Molecular Weight | 578.6 |
| InChIKey | ZUBJKBVXVWRIMV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C)n(-c2ccccc2)c2ccc(OC(=O)c3ccccc3NC(=O)c3c(OC)cccc3OC)cc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of ethyl 5-[2-[(2,6-dimethoxybenzoyl)amino]benzoyl]oxy-2-methyl-1-phenyl-indole-3-carboxylate? |
| A: Molecular formula of ethyl 5-[2-[(2,6-dimethoxybenzoyl)amino]benzoyl]oxy-2-methyl-1-phenyl-indole-3-carboxylate is C34H30N2O7. |
| Q: What is the InChIKey of ethyl 5-[2-[(2,6-dimethoxybenzoyl)amino]benzoyl]oxy-2-methyl-1-phenyl-indole-3-carboxylate? |
| A: InChIKey of ethyl 5-[2-[(2,6-dimethoxybenzoyl)amino]benzoyl]oxy-2-methyl-1-phenyl-indole-3-carboxylate is ZUBJKBVXVWRIMV-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 391862-33-2? |
| A: Chinese name of 391862-33-2 is 391862-33-2. |
| Q: What is the CAS number of ethyl 5-[2-[(2,6-dimethoxybenzoyl)amino]benzoyl]oxy-2-methyl-1-phenyl-indole-3-carboxylate? |
| A: CAS number of ethyl 5-[2-[(2,6-dimethoxybenzoyl)amino]benzoyl]oxy-2-methyl-1-phenyl-indole-3-carboxylate is 391862-33-2. |
| Q: What is the molecular weight of ethyl 5-[2-[(2,6-dimethoxybenzoyl)amino]benzoyl]oxy-2-methyl-1-phenyl-indole-3-carboxylate? |
| A: Molecular weight of ethyl 5-[2-[(2,6-dimethoxybenzoyl)amino]benzoyl]oxy-2-methyl-1-phenyl-indole-3-carboxylate is 578.6. |
| Q: What is the English name of ethyl 5-[2-[(2,6-dimethoxybenzoyl)amino]benzoyl]oxy-2-methyl-1-phenyl-indole-3-carboxylate? |
| A: The English name of ethyl 5-[2-[(2,6-dimethoxybenzoyl)amino]benzoyl]oxy-2-methyl-1-phenyl-indole-3-carboxylate is ethyl 5-[2-[(2,6-dimethoxybenzoyl)amino]benzoyl]oxy-2-methyl-1-phenyl-indole-3-carboxylate. |
| Q: What is the SMILES notation of ethyl 5-[2-[(2,6-dimethoxybenzoyl)amino]benzoyl]oxy-2-methyl-1-phenyl-indole-3-carboxylate? |
| A: SMILES notation of ethyl 5-[2-[(2,6-dimethoxybenzoyl)amino]benzoyl]oxy-2-methyl-1-phenyl-indole-3-carboxylate is CCOC(=O)c1c(C)n(-c2ccccc2)c2ccc(OC(=O)c3ccccc3NC(=O)c3c(OC)cccc3OC)cc12. |