N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-2-methyl-3-nitro-benzamide
Modify Date: 2026-07-13 17:29:43
![N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-2-methyl-3-nitro-benzamide Structure](https://www.chemsrc.com/extcaspic/090/391863-08-4.png)
N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-2-methyl-3-nitro-benzamide structure
|
Common Name | N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-2-methyl-3-nitro-benzamide | ||
|---|---|---|---|---|
| CAS Number | 391863-08-4 | Molecular Weight | 358.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H11FN4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-2-methyl-3-nitro-benzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H11FN4O3S |
|---|---|
| Molecular Weight | 358.3 |
| InChIKey | XMSVRXZIRCEPRI-UHFFFAOYSA-N |
| SMILES | Cc1c(C(=O)Nc2nnc(-c3ccc(F)cc3)s2)cccc1[N+](=O)[O-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-2-methyl-3-nitro-benzamide? |
| A: The English name of N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-2-methyl-3-nitro-benzamide is N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-2-methyl-3-nitro-benzamide. |
| Q: What is the molecular weight of N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-2-methyl-3-nitro-benzamide? |
| A: Molecular weight of N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-2-methyl-3-nitro-benzamide is 358.3. |
| Q: What is the CAS number of N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-2-methyl-3-nitro-benzamide? |
| A: CAS number of N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-2-methyl-3-nitro-benzamide is 391863-08-4. |
| Q: What is the InChIKey of N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-2-methyl-3-nitro-benzamide? |
| A: InChIKey of N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-2-methyl-3-nitro-benzamide is XMSVRXZIRCEPRI-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 391863-08-4? |
| A: Chinese name of 391863-08-4 is 391863-08-4. |
| Q: What is the molecular formula of N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-2-methyl-3-nitro-benzamide? |
| A: Molecular formula of N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-2-methyl-3-nitro-benzamide is C16H11FN4O3S. |
| Q: What is the SMILES notation of N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-2-methyl-3-nitro-benzamide? |
| A: SMILES notation of N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-2-methyl-3-nitro-benzamide is Cc1c(C(=O)Nc2nnc(-c3ccc(F)cc3)s2)cccc1[N+](=O)[O-]. |